C16H28N2O2 — CID 58324763
tert-butyl N-[(1R,3S)-5-(aminomethyl)-2-adamantyl]carbamate (PubChem CID 58324763) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S)-5-(aminomethyl)-2-adamantyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3S)-5-(aminomethyl)-2-adamantyl]carbamate |
|---|---|
| PubChem CID | 58324763 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | tert-butyl N-[(1R,3S)-5-(aminomethyl)-2-adamantyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1[C@@H]2CC3C[C@H]1CC(CN)(C3)C2 |
| InChI | InChI=1S/C16H28N2O2/c1-15(2,3)20-14(19)18-13-11-4-10-5-12(13)8-16(6-10,7-11)9-17/h10-13H,4-9,17H2,1-3H3,(H,18,19)/t10?,11-,12+,13?,16? |
| InChIKey | KWCUALNWVARYGO-WQCWHULMSA-N |
| XLogP | 2.66 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |