C22H34O6 — CID 22239577
1-O-tert-butyl 2-O-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] adamantane-1,2-dicarboxylate (PubChem CID 22239577) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] adamantane-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] adamantane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 22239577 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 1-O-tert-butyl 2-O-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] adamantane-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)COC(=O)C1C2CC3CC(C2)CC1(C(=O)OC(C)(C)C)C3 |
| InChI | InChI=1S/C22H34O6/c1-20(2,3)27-16(23)12-26-18(24)17-15-8-13-7-14(9-15)11-22(17,10-13)19(25)28-21(4,5)6/h13-15,17H,7-12H2,1-6H3 |
| InChIKey | RMOKSKJJSZODKW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|