C29H42N2O6 — CID 90891582
bis(1-carbamoyl-2-adamantyl) 3,3-dimethylpentanedioate (PubChem CID 90891582) has the molecular formula C29H42N2O6 and a molecular weight of 514.66 g/mol. Its IUPAC name is bis(1-carbamoyl-2-adamantyl) 3,3-dimethylpentanedioate.
| Compound Name | bis(1-carbamoyl-2-adamantyl) 3,3-dimethylpentanedioate |
|---|---|
| PubChem CID | 90891582 |
| Molecular Formula | C29H42N2O6 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | bis(1-carbamoyl-2-adamantyl) 3,3-dimethylpentanedioate |
| SMILES | CC(C)(CC(=O)OC1C2CC3CC(C2)CC1(C(N)=O)C3)CC(=O)OC1C2CC3CC(C2)CC1(C(N)=O)C3 |
| InChI | InChI=1S/C29H42N2O6/c1-27(2,13-21(32)36-23-19-5-15-3-16(6-19)10-28(23,9-15)25(30)34)14-22(33)37-24-20-7-17-4-18(8-20)12-29(24,11-17)26(31)35/h15-20,23-24H,3-14H2,1-2H3,(H2,30,34)(H2,31,35) |
| InChIKey | TZHDJUSZUZYSKC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |