C19H31N3O5S — CID 91465141
(1-carbamoyl-2-adamantyl) 1-[2-(methanesulfonamido)ethyl]pyrrolidine-2-carboxylate (PubChem CID 91465141) has the molecular formula C19H31N3O5S and a molecular weight of 413.54 g/mol. Its IUPAC name is (1-carbamoyl-2-adamantyl) 1-[2-(methanesulfonamido)ethyl]pyrrolidine-2-carboxylate.
| Compound Name | (1-carbamoyl-2-adamantyl) 1-[2-(methanesulfonamido)ethyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 91465141 |
| Molecular Formula | C19H31N3O5S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (1-carbamoyl-2-adamantyl) 1-[2-(methanesulfonamido)ethyl]pyrrolidine-2-carboxylate |
| SMILES | CS(=O)(=O)NCCN1CCCC1C(=O)OC1C2CC3CC(C2)CC1(C(N)=O)C3 |
| InChI | InChI=1S/C19H31N3O5S/c1-28(25,26)21-4-6-22-5-2-3-15(22)17(23)27-16-14-8-12-7-13(9-14)11-19(16,10-12)18(20)24/h12-16,21H,2-11H2,1H3,(H2,20,24) |
| InChIKey | CROHBMXMSKIHKG-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |