C23H39NO4 — CID 174557522
ditert-butyl (2R)-2-(1-adamantyl)-2-aminopentanedioate (PubChem CID 174557522) has the molecular formula C23H39NO4 and a molecular weight of 393.57 g/mol. Its IUPAC name is ditert-butyl (2R)-2-(1-adamantyl)-2-aminopentanedioate.
| Compound Name | ditert-butyl (2R)-2-(1-adamantyl)-2-aminopentanedioate |
|---|---|
| PubChem CID | 174557522 |
| Molecular Formula | C23H39NO4 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | ditert-butyl (2R)-2-(1-adamantyl)-2-aminopentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@](N)(C(=O)OC(C)(C)C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H39NO4/c1-20(2,3)27-18(25)7-8-23(24,19(26)28-21(4,5)6)22-12-15-9-16(13-22)11-17(10-15)14-22/h15-17H,7-14,24H2,1-6H3/t15?,16?,17?,22?,23-/m0/s1 |
| InChIKey | ZXUFNXSOXROAAQ-FPJYJELGSA-N |
| XLogP | 4.36 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |