C24H29N5O2 — CID 22240887
4-[2-[(4-tert-butylphenyl)methyl]tetrazol-5-yl]-4-phenylpiperidine-1-carboxylic acid (PubChem CID 22240887) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 4-[2-[(4-tert-butylphenyl)methyl]tetrazol-5-yl]-4-phenylpiperidine-1-carboxylic acid.
| Compound Name | 4-[2-[(4-tert-butylphenyl)methyl]tetrazol-5-yl]-4-phenylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22240887 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 4-[2-[(4-tert-butylphenyl)methyl]tetrazol-5-yl]-4-phenylpiperidine-1-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(Cn2nnc(C3(c4ccccc4)CCN(C(=O)O)CC3)n2)cc1 |
| InChI | InChI=1S/C24H29N5O2/c1-23(2,3)19-11-9-18(10-12-19)17-29-26-21(25-27-29)24(20-7-5-4-6-8-20)13-15-28(16-14-24)22(30)31/h4-12H,13-17H2,1-3H3,(H,30,31) |
| InChIKey | AJPNHRVWKCSWNE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |