C33H42N7O3S+ — CID 58842951
[3-[4-[2-[2-(methanesulfonamido)ethyl]tetrazol-5-yl]-4-phenylpiperidin-1-yl]-1,1-diphenylpropoxy]methylidene-dimethylazanium (PubChem CID 58842951) has the molecular formula C33H42N7O3S+ and a molecular weight of 616.81 g/mol. Its IUPAC name is [3-[4-[2-[2-(methanesulfonamido)ethyl]tetrazol-5-yl]-4-phenylpiperidin-1-yl]-1,1-diphenylpropoxy]methylidene-dimethylazanium.
| Compound Name | [3-[4-[2-[2-(methanesulfonamido)ethyl]tetrazol-5-yl]-4-phenylpiperidin-1-yl]-1,1-diphenylpropoxy]methylidene-dimethylazanium |
|---|---|
| PubChem CID | 58842951 |
| Molecular Formula | C33H42N7O3S+ |
| Molecular Weight | 616.81 g/mol |
| Exact Mass | 616.31 |
| IUPAC Name | [3-[4-[2-[2-(methanesulfonamido)ethyl]tetrazol-5-yl]-4-phenylpiperidin-1-yl]-1,1-diphenylpropoxy]methylidene-dimethylazanium |
| SMILES | C[N+](C)=COC(CCN1CCC(c2ccccc2)(c2nnn(CCNS(C)(=O)=O)n2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H42N7O3S/c1-38(2)27-43-33(29-15-9-5-10-16-29,30-17-11-6-12-18-30)21-25-39-23-19-32(20-24-39,28-13-7-4-8-14-28)31-35-37-40(36-31)26-22-34-44(3,41)42/h4-18,27,34H,19-26H2,1-3H3/q+1 |
| InChIKey | YJOKXCXSMQIKJJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.81 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|