C14H30O2Si — CID 22242240
butan-2-yl-ethenyl-bis[(2-methylpropan-2-yl)oxy]silane (PubChem CID 22242240) has the molecular formula C14H30O2Si and a molecular weight of 258.48 g/mol. Its IUPAC name is butan-2-yl-ethenyl-bis[(2-methylpropan-2-yl)oxy]silane.
| Compound Name | butan-2-yl-ethenyl-bis[(2-methylpropan-2-yl)oxy]silane |
|---|---|
| PubChem CID | 22242240 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | butan-2-yl-ethenyl-bis[(2-methylpropan-2-yl)oxy]silane |
| SMILES | C=C[Si](OC(C)(C)C)(OC(C)(C)C)C(C)CC |
| InChI | InChI=1S/C14H30O2Si/c1-10-12(3)17(11-2,15-13(4,5)6)16-14(7,8)9/h11-12H,2,10H2,1,3-9H3 |
| InChIKey | FMSGFCJTUPBWJB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|