C17H34O2Si — CID 87879688
[di(butan-2-yl)-(2,3-dimethylbutan-2-yl)silyl] prop-2-enoate (PubChem CID 87879688) has the molecular formula C17H34O2Si and a molecular weight of 298.54 g/mol. Its IUPAC name is [di(butan-2-yl)-(2,3-dimethylbutan-2-yl)silyl] prop-2-enoate.
| Compound Name | [di(butan-2-yl)-(2,3-dimethylbutan-2-yl)silyl] prop-2-enoate |
|---|---|
| PubChem CID | 87879688 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | [di(butan-2-yl)-(2,3-dimethylbutan-2-yl)silyl] prop-2-enoate |
| SMILES | C=CC(=O)O[Si](C(C)CC)(C(C)CC)C(C)(C)C(C)C |
| InChI | InChI=1S/C17H34O2Si/c1-10-14(6)20(15(7)11-2,19-16(18)12-3)17(8,9)13(4)5/h12-15H,3,10-11H2,1-2,4-9H3 |
| InChIKey | WSUWLGBCHGOCFP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|