C16H32O2Si — CID 18377594
[butan-2-yl-(2-methylbutan-2-yl)-propan-2-ylsilyl] 2-methylprop-2-enoate (PubChem CID 18377594) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is [butan-2-yl-(2-methylbutan-2-yl)-propan-2-ylsilyl] 2-methylprop-2-enoate.
| Compound Name | [butan-2-yl-(2-methylbutan-2-yl)-propan-2-ylsilyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18377594 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | [butan-2-yl-(2-methylbutan-2-yl)-propan-2-ylsilyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[Si](C(C)C)(C(C)CC)C(C)(C)CC |
| InChI | InChI=1S/C16H32O2Si/c1-10-14(7)19(13(5)6,16(8,9)11-2)18-15(17)12(3)4/h13-14H,3,10-11H2,1-2,4-9H3 |
| InChIKey | JNUNZPDJBSLHHD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|