C27H62O6Si5 — CID 87430550
[[bis(triethylsilyloxy)-trimethylsilyloxysilyl]oxy-di(butan-2-yl)silyl] 2-methylprop-2-enoate (PubChem CID 87430550) has the molecular formula C27H62O6Si5 and a molecular weight of 623.22 g/mol. Its IUPAC name is [[bis(triethylsilyloxy)-trimethylsilyloxysilyl]oxy-di(butan-2-yl)silyl] 2-methylprop-2-enoate.
| Compound Name | [[bis(triethylsilyloxy)-trimethylsilyloxysilyl]oxy-di(butan-2-yl)silyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87430550 |
| Molecular Formula | C27H62O6Si5 |
| Molecular Weight | 623.22 g/mol |
| Exact Mass | 622.34 |
| IUPAC Name | [[bis(triethylsilyloxy)-trimethylsilyloxysilyl]oxy-di(butan-2-yl)silyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[Si](O[Si](O[Si](C)(C)C)(O[Si](CC)(CC)CC)O[Si](CC)(CC)CC)(C(C)CC)C(C)CC |
| InChI | InChI=1S/C27H62O6Si5/c1-16-25(11)37(26(12)17-2,29-27(28)24(9)10)33-38(30-34(13,14)15,31-35(18-3,19-4)20-5)32-36(21-6,22-7)23-8/h25-26H,9,16-23H2,1-8,10-15H3 |
| InChIKey | DYRRERPFGSKRFP-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.22 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|