C13H32O5Si4 — CID 23108290
tris(trimethylsilyloxy)silyl 2-methylprop-2-enoate (PubChem CID 23108290) has the molecular formula C13H32O5Si4 and a molecular weight of 380.74 g/mol. Its IUPAC name is tris(trimethylsilyloxy)silyl 2-methylprop-2-enoate.
| Compound Name | tris(trimethylsilyloxy)silyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 23108290 |
| Molecular Formula | C13H32O5Si4 |
| Molecular Weight | 380.74 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | tris(trimethylsilyloxy)silyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H32O5Si4/c1-12(2)13(14)15-22(16-19(3,4)5,17-20(6,7)8)18-21(9,10)11/h1H2,2-11H3 |
| InChIKey | LFRMZXWVNHFDFI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.74 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|