C16H24O7Si — CID 88695289
[butoxy-bis(2-methylprop-2-enoyloxy)silyl] 2-methylprop-2-enoate (PubChem CID 88695289) has the molecular formula C16H24O7Si and a molecular weight of 356.45 g/mol. Its IUPAC name is [butoxy-bis(2-methylprop-2-enoyloxy)silyl] 2-methylprop-2-enoate.
| Compound Name | [butoxy-bis(2-methylprop-2-enoyloxy)silyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88695289 |
| Molecular Formula | C16H24O7Si |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [butoxy-bis(2-methylprop-2-enoyloxy)silyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[Si](OCCCC)(OC(=O)C(=C)C)OC(=O)C(=C)C |
| InChI | InChI=1S/C16H24O7Si/c1-8-9-10-20-24(21-14(17)11(2)3,22-15(18)12(4)5)23-16(19)13(6)7/h2,4,6,8-10H2,1,3,5,7H3 |
| InChIKey | LXZQCSQIRHBCBI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|