C34H90O11Si12 — CID 18508468
3,3,3-tris[tris(trimethylsilyloxy)silyl]propyl 2-methylprop-2-enoate (PubChem CID 18508468) has the molecular formula C34H90O11Si12 and a molecular weight of 1012.11 g/mol. Its IUPAC name is 3,3,3-tris[tris(trimethylsilyloxy)silyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3,3,3-tris[tris(trimethylsilyloxy)silyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18508468 |
| Molecular Formula | C34H90O11Si12 |
| Molecular Weight | 1012.11 g/mol |
| Exact Mass | 1010.37 |
| IUPAC Name | 3,3,3-tris[tris(trimethylsilyloxy)silyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC([Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)([Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C34H90O11Si12/c1-32(2)33(35)36-31-30-34(55(37-46(3,4)5,38-47(6,7)8)39-48(9,10)11,56(40-49(12,13)14,41-50(15,16)17)42-51(18,19)20)57(43-52(21,22)23,44-53(24,25)26)45-54(27,28)29/h1,30-31H2,2-29H3 |
| InChIKey | WRWFSYHNCJXXTR-UHFFFAOYSA-N |
| XLogP | 11.79 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1012.11 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|