C25H58O6Si5 — CID 87430614
[[bis(triethylsilyloxy)-trimethylsilyloxysilyl]oxy-di(propan-2-yl)silyl] 2-methylprop-2-enoate (PubChem CID 87430614) has the molecular formula C25H58O6Si5 and a molecular weight of 595.16 g/mol. Its IUPAC name is [[bis(triethylsilyloxy)-trimethylsilyloxysilyl]oxy-di(propan-2-yl)silyl] 2-methylprop-2-enoate.
| Compound Name | [[bis(triethylsilyloxy)-trimethylsilyloxysilyl]oxy-di(propan-2-yl)silyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87430614 |
| Molecular Formula | C25H58O6Si5 |
| Molecular Weight | 595.16 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | [[bis(triethylsilyloxy)-trimethylsilyloxysilyl]oxy-di(propan-2-yl)silyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[Si](O[Si](O[Si](C)(C)C)(O[Si](CC)(CC)CC)O[Si](CC)(CC)CC)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H58O6Si5/c1-16-33(17-2,18-3)29-36(28-32(13,14)15,30-34(19-4,20-5)21-6)31-35(23(9)10,24(11)12)27-25(26)22(7)8/h23-24H,7,16-21H2,1-6,8-15H3 |
| InChIKey | LAXXHDFAZFFXOI-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.16 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|