C23H31NO4S — CID 22246825
2-[3-[[(4-butylphenyl)methyl-propylsulfonylamino]methyl]phenyl]acetic acid (PubChem CID 22246825) has the molecular formula C23H31NO4S and a molecular weight of 417.57 g/mol. Its IUPAC name is 2-[3-[[(4-butylphenyl)methyl-propylsulfonylamino]methyl]phenyl]acetic acid.
| Compound Name | 2-[3-[[(4-butylphenyl)methyl-propylsulfonylamino]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 22246825 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 2-[3-[[(4-butylphenyl)methyl-propylsulfonylamino]methyl]phenyl]acetic acid |
| SMILES | CCCCc1ccc(CN(Cc2cccc(CC(=O)O)c2)S(=O)(=O)CCC)cc1 |
| InChI | InChI=1S/C23H31NO4S/c1-3-5-7-19-10-12-20(13-11-19)17-24(29(27,28)14-4-2)18-22-9-6-8-21(15-22)16-23(25)26/h6,8-13,15H,3-5,7,14,16-18H2,1-2H3,(H,25,26) |
| InChIKey | JIDCZXLUMKXERQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |