C27H28N2O4S — CID 18376238
2-[3-[[(4-butylphenyl)methyl-(4-cyanophenyl)sulfonylamino]methyl]phenyl]acetic acid (PubChem CID 18376238) has the molecular formula C27H28N2O4S and a molecular weight of 476.60 g/mol. Its IUPAC name is 2-[3-[[(4-butylphenyl)methyl-(4-cyanophenyl)sulfonylamino]methyl]phenyl]acetic acid.
| Compound Name | 2-[3-[[(4-butylphenyl)methyl-(4-cyanophenyl)sulfonylamino]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 18376238 |
| Molecular Formula | C27H28N2O4S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 2-[3-[[(4-butylphenyl)methyl-(4-cyanophenyl)sulfonylamino]methyl]phenyl]acetic acid |
| SMILES | CCCCc1ccc(CN(Cc2cccc(CC(=O)O)c2)S(=O)(=O)c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C27H28N2O4S/c1-2-3-5-21-8-10-23(11-9-21)19-29(20-25-7-4-6-24(16-25)17-27(30)31)34(32,33)26-14-12-22(18-28)13-15-26/h4,6-16H,2-3,5,17,19-20H2,1H3,(H,30,31) |
| InChIKey | RCGAKYZEAFJKIJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |