C30H36N2O5S — CID 174429772
2-[3-[[[4-(1-hydroxyhexyl)phenyl]methyl-(1-pyridin-3-ylprop-2-enylsulfonyl)amino]methyl]phenyl]acetic acid (PubChem CID 174429772) has the molecular formula C30H36N2O5S and a molecular weight of 536.69 g/mol. Its IUPAC name is 2-[3-[[[4-(1-hydroxyhexyl)phenyl]methyl-(1-pyridin-3-ylprop-2-enylsulfonyl)amino]methyl]phenyl]acetic acid.
| Compound Name | 2-[3-[[[4-(1-hydroxyhexyl)phenyl]methyl-(1-pyridin-3-ylprop-2-enylsulfonyl)amino]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 174429772 |
| Molecular Formula | C30H36N2O5S |
| Molecular Weight | 536.69 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 2-[3-[[[4-(1-hydroxyhexyl)phenyl]methyl-(1-pyridin-3-ylprop-2-enylsulfonyl)amino]methyl]phenyl]acetic acid |
| SMILES | C=CC(c1cccnc1)S(=O)(=O)N(Cc1ccc(C(O)CCCCC)cc1)Cc1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C30H36N2O5S/c1-3-5-6-12-28(33)26-15-13-23(14-16-26)21-32(22-25-10-7-9-24(18-25)19-30(34)35)38(36,37)29(4-2)27-11-8-17-31-20-27/h4,7-11,13-18,20,28-29,33H,2-3,5-6,12,19,21-22H2,1H3,(H,34,35) |
| InChIKey | CJBKXEOTSCCKRH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.69 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|