C25H30N4O4S — CID 174403147
7-[(4-pyrazol-1-ylphenyl)methyl-(1-pyridin-3-ylprop-2-enylsulfonyl)amino]heptanoic acid (PubChem CID 174403147) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is 7-[(4-pyrazol-1-ylphenyl)methyl-(1-pyridin-3-ylprop-2-enylsulfonyl)amino]heptanoic acid.
| Compound Name | 7-[(4-pyrazol-1-ylphenyl)methyl-(1-pyridin-3-ylprop-2-enylsulfonyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 174403147 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 7-[(4-pyrazol-1-ylphenyl)methyl-(1-pyridin-3-ylprop-2-enylsulfonyl)amino]heptanoic acid |
| SMILES | C=CC(c1cccnc1)S(=O)(=O)N(CCCCCCC(=O)O)Cc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C25H30N4O4S/c1-2-24(22-9-7-15-26-19-22)34(32,33)28(17-6-4-3-5-10-25(30)31)20-21-11-13-23(14-12-21)29-18-8-16-27-29/h2,7-9,11-16,18-19,24H,1,3-6,10,17,20H2,(H,30,31) |
| InChIKey | KECBFALHZQXKPJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|