C28H26N2O5S — CID 174402415
2-[3-[[(5-phenylfuran-2-yl)methyl-(1-pyridin-3-ylprop-2-enylsulfonyl)amino]methyl]phenyl]acetic acid (PubChem CID 174402415) has the molecular formula C28H26N2O5S and a molecular weight of 502.59 g/mol. Its IUPAC name is 2-[3-[[(5-phenylfuran-2-yl)methyl-(1-pyridin-3-ylprop-2-enylsulfonyl)amino]methyl]phenyl]acetic acid.
| Compound Name | 2-[3-[[(5-phenylfuran-2-yl)methyl-(1-pyridin-3-ylprop-2-enylsulfonyl)amino]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 174402415 |
| Molecular Formula | C28H26N2O5S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 2-[3-[[(5-phenylfuran-2-yl)methyl-(1-pyridin-3-ylprop-2-enylsulfonyl)amino]methyl]phenyl]acetic acid |
| SMILES | C=CC(c1cccnc1)S(=O)(=O)N(Cc1cccc(CC(=O)O)c1)Cc1ccc(-c2ccccc2)o1 |
| InChI | InChI=1S/C28H26N2O5S/c1-2-27(24-12-7-15-29-18-24)36(33,34)30(19-22-9-6-8-21(16-22)17-28(31)32)20-25-13-14-26(35-25)23-10-4-3-5-11-23/h2-16,18,27H,1,17,19-20H2,(H,31,32) |
| InChIKey | PRKBQTKUGWUVMG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|