C25H24N4O2S — CID 174403395
N-benzyl-N-[(4-pyrazol-1-ylphenyl)methyl]-1-pyridin-3-ylprop-2-ene-1-sulfonamide (PubChem CID 174403395) has the molecular formula C25H24N4O2S and a molecular weight of 444.56 g/mol. Its IUPAC name is N-benzyl-N-[(4-pyrazol-1-ylphenyl)methyl]-1-pyridin-3-ylprop-2-ene-1-sulfonamide.
| Compound Name | N-benzyl-N-[(4-pyrazol-1-ylphenyl)methyl]-1-pyridin-3-ylprop-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 174403395 |
| Molecular Formula | C25H24N4O2S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | N-benzyl-N-[(4-pyrazol-1-ylphenyl)methyl]-1-pyridin-3-ylprop-2-ene-1-sulfonamide |
| SMILES | C=CC(c1cccnc1)S(=O)(=O)N(Cc1ccccc1)Cc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C25H24N4O2S/c1-2-25(23-10-6-15-26-18-23)32(30,31)28(19-21-8-4-3-5-9-21)20-22-11-13-24(14-12-22)29-17-7-16-27-29/h2-18,25H,1,19-20H2 |
| InChIKey | IOGFYTTZNXWRQL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|