C20H21NO7 — CID 22247185
dicyclopentyl 2-hydroxy-1,3-dioxoisoindole-5,6-dicarboxylate (PubChem CID 22247185) has the molecular formula C20H21NO7 and a molecular weight of 387.39 g/mol. Its IUPAC name is dicyclopentyl 2-hydroxy-1,3-dioxoisoindole-5,6-dicarboxylate.
| Compound Name | dicyclopentyl 2-hydroxy-1,3-dioxoisoindole-5,6-dicarboxylate |
|---|---|
| PubChem CID | 22247185 |
| Molecular Formula | C20H21NO7 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | dicyclopentyl 2-hydroxy-1,3-dioxoisoindole-5,6-dicarboxylate |
| SMILES | O=C(OC1CCCC1)c1cc2c(cc1C(=O)OC1CCCC1)C(=O)N(O)C2=O |
| InChI | InChI=1S/C20H21NO7/c22-17-13-9-15(19(24)27-11-5-1-2-6-11)16(10-14(13)18(23)21(17)26)20(25)28-12-7-3-4-8-12/h9-12,26H,1-8H2 |
| InChIKey | NHOROSAVNFKYJI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|