About 2-heptan-3-yloxypyrazine
2-heptan-3-yloxypyrazine (PubChem CID 22248979) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-heptan-3-yloxypyrazine.
Molecular Properties
| Compound Name | 2-heptan-3-yloxypyrazine |
| PubChem CID | 22248979 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-heptan-3-yloxypyrazine |
| SMILES | CCCCC(CC)Oc1cnccn1 |
| InChI | InChI=1S/C11H18N2O/c1-3-5-6-10(4-2)14-11-9-12-7-8-13-11/h7-10H,3-6H2,1-2H3 |
| InChIKey | HNYDDJYVGSEALE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-heptan-3-yloxypyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptan-3-yloxypyrazine?
The IUPAC name of 2-heptan-3-yloxypyrazine (CID 22248979) is 2-heptan-3-yloxypyrazine.
What is the SMILES notation for 2-heptan-3-yloxypyrazine?
The canonical SMILES for 2-heptan-3-yloxypyrazine is CCCCC(CC)Oc1cnccn1.
What is the InChIKey of 2-heptan-3-yloxypyrazine?
The InChIKey is HNYDDJYVGSEALE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c1-3-5-6-10(4-2)14-11-9-12-7-8-13-11/h7-10H,3-6H2,1-2H3.
What are the key properties of 2-heptan-3-yloxypyrazine?
2-heptan-3-yloxypyrazine has a molecular weight of 194.28 g/mol, XLogP of 2.82, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptan-3-yloxypyrazine is sourced from PubChem (CID 22248979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).