C31H62N2 — CID 22251678
N,N'-bis(2,6-ditert-butylcyclohexyl)propane-1,3-diamine (PubChem CID 22251678) has the molecular formula C31H62N2 and a molecular weight of 462.85 g/mol. Its IUPAC name is N,N'-bis(2,6-ditert-butylcyclohexyl)propane-1,3-diamine.
| Compound Name | N,N'-bis(2,6-ditert-butylcyclohexyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 22251678 |
| Molecular Formula | C31H62N2 |
| Molecular Weight | 462.85 g/mol |
| Exact Mass | 462.49 |
| IUPAC Name | N,N'-bis(2,6-ditert-butylcyclohexyl)propane-1,3-diamine |
| SMILES | CC(C)(C)C1CCCC(C(C)(C)C)C1NCCCNC1C(C(C)(C)C)CCCC1C(C)(C)C |
| InChI | InChI=1S/C31H62N2/c1-28(2,3)22-16-13-17-23(29(4,5)6)26(22)32-20-15-21-33-27-24(30(7,8)9)18-14-19-25(27)31(10,11)12/h22-27,32-33H,13-21H2,1-12H3 |
| InChIKey | MFEYXJHANDXPEO-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.85 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|