C27H24F4N2O4 — CID 22262253
N-[1-(4-fluorophenyl)-1-hydroxy-3-[4-(trifluoromethyl)phenyl]propan-2-yl]-4-nitro-5,6,7,8-tetrahydronaphthalene-1-carboxamide (PubChem CID 22262253) has the molecular formula C27H24F4N2O4 and a molecular weight of 516.49 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-1-hydroxy-3-[4-(trifluoromethyl)phenyl]propan-2-yl]-4-nitro-5,6,7,8-tetrahydronaphthalene-1-carboxamide.
| Compound Name | N-[1-(4-fluorophenyl)-1-hydroxy-3-[4-(trifluoromethyl)phenyl]propan-2-yl]-4-nitro-5,6,7,8-tetrahydronaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 22262253 |
| Molecular Formula | C27H24F4N2O4 |
| Molecular Weight | 516.49 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | N-[1-(4-fluorophenyl)-1-hydroxy-3-[4-(trifluoromethyl)phenyl]propan-2-yl]-4-nitro-5,6,7,8-tetrahydronaphthalene-1-carboxamide |
| SMILES | O=C(NC(Cc1ccc(C(F)(F)F)cc1)C(O)c1ccc(F)cc1)c1ccc([N+](=O)[O-])c2c1CCCC2 |
| InChI | InChI=1S/C27H24F4N2O4/c28-19-11-7-17(8-12-19)25(34)23(15-16-5-9-18(10-6-16)27(29,30)31)32-26(35)22-13-14-24(33(36)37)21-4-2-1-3-20(21)22/h5-14,23,25,34H,1-4,15H2,(H,32,35) |
| InChIKey | GSGQWODLIKAEOT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.49 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|