C20H15Br2NO2 — CID 22269850
2-[4-(3,5-dibromophenyl)-2-methylanilino]benzoic acid (PubChem CID 22269850) has the molecular formula C20H15Br2NO2 and a molecular weight of 461.15 g/mol. Its IUPAC name is 2-[4-(3,5-dibromophenyl)-2-methylanilino]benzoic acid.
| Compound Name | 2-[4-(3,5-dibromophenyl)-2-methylanilino]benzoic acid |
|---|---|
| PubChem CID | 22269850 |
| Molecular Formula | C20H15Br2NO2 |
| Molecular Weight | 461.15 g/mol |
| Exact Mass | 458.95 |
| IUPAC Name | 2-[4-(3,5-dibromophenyl)-2-methylanilino]benzoic acid |
| SMILES | Cc1cc(-c2cc(Br)cc(Br)c2)ccc1Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C20H15Br2NO2/c1-12-8-13(14-9-15(21)11-16(22)10-14)6-7-18(12)23-19-5-3-2-4-17(19)20(24)25/h2-11,23H,1H3,(H,24,25) |
| InChIKey | ZKGMMDZZJXJFLP-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.15 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |