C27H35N5O4S — CID 22272689
2-[4-[2-(1,3-benzoxazol-2-ylsulfanyl)ethyl]piperazin-1-yl]-N-[3-nitro-2,6-di(propan-2-yl)phenyl]acetamide (PubChem CID 22272689) has the molecular formula C27H35N5O4S and a molecular weight of 525.68 g/mol. Its IUPAC name is 2-[4-[2-(1,3-benzoxazol-2-ylsulfanyl)ethyl]piperazin-1-yl]-N-[3-nitro-2,6-di(propan-2-yl)phenyl]acetamide.
| Compound Name | 2-[4-[2-(1,3-benzoxazol-2-ylsulfanyl)ethyl]piperazin-1-yl]-N-[3-nitro-2,6-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 22272689 |
| Molecular Formula | C27H35N5O4S |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | 2-[4-[2-(1,3-benzoxazol-2-ylsulfanyl)ethyl]piperazin-1-yl]-N-[3-nitro-2,6-di(propan-2-yl)phenyl]acetamide |
| SMILES | CC(C)c1ccc([N+](=O)[O-])c(C(C)C)c1NC(=O)CN1CCN(CCSc2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C27H35N5O4S/c1-18(2)20-9-10-22(32(34)35)25(19(3)4)26(20)29-24(33)17-31-13-11-30(12-14-31)15-16-37-27-28-21-7-5-6-8-23(21)36-27/h5-10,18-19H,11-17H2,1-4H3,(H,29,33) |
| InChIKey | AHTPDCOJJUVTFR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|