C28H37N5O4S — CID 22272626
2-[4-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]piperazin-1-yl]-N-[3-nitro-2,6-di(propan-2-yl)phenyl]acetamide (PubChem CID 22272626) has the molecular formula C28H37N5O4S and a molecular weight of 539.70 g/mol. Its IUPAC name is 2-[4-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]piperazin-1-yl]-N-[3-nitro-2,6-di(propan-2-yl)phenyl]acetamide.
| Compound Name | 2-[4-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]piperazin-1-yl]-N-[3-nitro-2,6-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 22272626 |
| Molecular Formula | C28H37N5O4S |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | 2-[4-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]piperazin-1-yl]-N-[3-nitro-2,6-di(propan-2-yl)phenyl]acetamide |
| SMILES | CC(C)c1ccc([N+](=O)[O-])c(C(C)C)c1NC(=O)CN1CCN(CCCSc2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C28H37N5O4S/c1-19(2)21-10-11-23(33(35)36)26(20(3)4)27(21)30-25(34)18-32-15-13-31(14-16-32)12-7-17-38-28-29-22-8-5-6-9-24(22)37-28/h5-6,8-11,19-20H,7,12-18H2,1-4H3,(H,30,34) |
| InChIKey | VWAWIETXVSMVPL-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|