C8H7N2O5PS — CID 22280668
[2-(2-carbamoyl-1,3-thiazol-4-yl)furan-3-yl]phosphonic acid (PubChem CID 22280668) has the molecular formula C8H7N2O5PS and a molecular weight of 274.19 g/mol. Its IUPAC name is [2-(2-carbamoyl-1,3-thiazol-4-yl)furan-3-yl]phosphonic acid.
| Compound Name | [2-(2-carbamoyl-1,3-thiazol-4-yl)furan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 22280668 |
| Molecular Formula | C8H7N2O5PS |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | [2-(2-carbamoyl-1,3-thiazol-4-yl)furan-3-yl]phosphonic acid |
| SMILES | NC(=O)c1nc(-c2occc2P(=O)(O)O)cs1 |
| InChI | InChI=1S/C8H7N2O5PS/c9-7(11)8-10-4(3-17-8)6-5(1-2-15-6)16(12,13)14/h1-3H,(H2,9,11)(H2,12,13,14) |
| InChIKey | HHWMFBINPJRVNW-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|