C10H12NO4PS — CID 22280661
[2-(2-propan-2-yl-1,3-thiazol-4-yl)furan-3-yl]phosphonic acid (PubChem CID 22280661) has the molecular formula C10H12NO4PS and a molecular weight of 273.25 g/mol. Its IUPAC name is [2-(2-propan-2-yl-1,3-thiazol-4-yl)furan-3-yl]phosphonic acid.
| Compound Name | [2-(2-propan-2-yl-1,3-thiazol-4-yl)furan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 22280661 |
| Molecular Formula | C10H12NO4PS |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | [2-(2-propan-2-yl-1,3-thiazol-4-yl)furan-3-yl]phosphonic acid |
| SMILES | CC(C)c1nc(-c2occc2P(=O)(O)O)cs1 |
| InChI | InChI=1S/C10H12NO4PS/c1-6(2)10-11-7(5-17-10)9-8(3-4-15-9)16(12,13)14/h3-6H,1-2H3,(H2,12,13,14) |
| InChIKey | OESLYKMFEHNJLL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|