C12H15ClNO4PS — CID 22280447
[2-[2-(chloromethyl)-5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-3-yl]phosphonic acid (PubChem CID 22280447) has the molecular formula C12H15ClNO4PS and a molecular weight of 335.75 g/mol. Its IUPAC name is [2-[2-(chloromethyl)-5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-3-yl]phosphonic acid.
| Compound Name | [2-[2-(chloromethyl)-5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 22280447 |
| Molecular Formula | C12H15ClNO4PS |
| Molecular Weight | 335.75 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | [2-[2-(chloromethyl)-5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-3-yl]phosphonic acid |
| SMILES | CC(C)Cc1sc(CCl)nc1-c1occc1P(=O)(O)O |
| InChI | InChI=1S/C12H15ClNO4PS/c1-7(2)5-9-11(14-10(6-13)20-9)12-8(3-4-18-12)19(15,16)17/h3-4,7H,5-6H2,1-2H3,(H2,15,16,17) |
| InChIKey | SKLDCRDLYLNXIG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.75 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|