C8H9N2O5PS — CID 22280638
[2-[2-amino-5-(hydroxymethyl)-1,3-thiazol-4-yl]furan-3-yl]phosphonic acid (PubChem CID 22280638) has the molecular formula C8H9N2O5PS and a molecular weight of 276.21 g/mol. Its IUPAC name is [2-[2-amino-5-(hydroxymethyl)-1,3-thiazol-4-yl]furan-3-yl]phosphonic acid.
| Compound Name | [2-[2-amino-5-(hydroxymethyl)-1,3-thiazol-4-yl]furan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 22280638 |
| Molecular Formula | C8H9N2O5PS |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | [2-[2-amino-5-(hydroxymethyl)-1,3-thiazol-4-yl]furan-3-yl]phosphonic acid |
| SMILES | Nc1nc(-c2occc2P(=O)(O)O)c(CO)s1 |
| InChI | InChI=1S/C8H9N2O5PS/c9-8-10-6(5(3-11)17-8)7-4(1-2-15-7)16(12,13)14/h1-2,11H,3H2,(H2,9,10)(H2,12,13,14) |
| InChIKey | VUYOXDUMZIVPSX-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|