C12H16N3O5PS — CID 22280679
[2-[2-amino-5-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]furan-3-yl]phosphonic acid (PubChem CID 22280679) has the molecular formula C12H16N3O5PS and a molecular weight of 345.32 g/mol. Its IUPAC name is [2-[2-amino-5-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]furan-3-yl]phosphonic acid.
| Compound Name | [2-[2-amino-5-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]furan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 22280679 |
| Molecular Formula | C12H16N3O5PS |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | [2-[2-amino-5-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]furan-3-yl]phosphonic acid |
| SMILES | Nc1nc(-c2occc2P(=O)(O)O)c(CN2CCOCC2)s1 |
| InChI | InChI=1S/C12H16N3O5PS/c13-12-14-10(11-8(1-4-20-11)21(16,17)18)9(22-12)7-15-2-5-19-6-3-15/h1,4H,2-3,5-7H2,(H2,13,14)(H2,16,17,18) |
| InChIKey | TVDBUXLQMVCPTE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|