C16H32N2 — CID 22280920
2-tridecan-3-yl-4,5-dihydro-1H-imidazole (PubChem CID 22280920) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 2-tridecan-3-yl-4,5-dihydro-1H-imidazole.
| Compound Name | 2-tridecan-3-yl-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 22280920 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 2-tridecan-3-yl-4,5-dihydro-1H-imidazole |
| SMILES | CCCCCCCCCCC(CC)C1=NCCN1 |
| InChI | InChI=1S/C16H32N2/c1-3-5-6-7-8-9-10-11-12-15(4-2)16-17-13-14-18-16/h15H,3-14H2,1-2H3,(H,17,18) |
| InChIKey | YIJPLGIYWWQTMS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|