C12H25N3 — CID 174587936
2-nonan-3-yl-4,5-dihydroimidazol-1-amine (PubChem CID 174587936) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is 2-nonan-3-yl-4,5-dihydroimidazol-1-amine.
| Compound Name | 2-nonan-3-yl-4,5-dihydroimidazol-1-amine |
|---|---|
| PubChem CID | 174587936 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 2-nonan-3-yl-4,5-dihydroimidazol-1-amine |
| SMILES | CCCCCCC(CC)C1=NCCN1N |
| InChI | InChI=1S/C12H25N3/c1-3-5-6-7-8-11(4-2)12-14-9-10-15(12)13/h11H,3-10,13H2,1-2H3 |
| InChIKey | PLJRFIHFOSIHTD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|