C22H45N2O5P — CID 70615729
2-(2-heptadec-1-en-9-yl-4,5-dihydroimidazol-1-yl)ethanol;phosphoric acid (PubChem CID 70615729) has the molecular formula C22H45N2O5P and a molecular weight of 448.59 g/mol. Its IUPAC name is 2-(2-heptadec-1-en-9-yl-4,5-dihydroimidazol-1-yl)ethanol;phosphoric acid.
| Compound Name | 2-(2-heptadec-1-en-9-yl-4,5-dihydroimidazol-1-yl)ethanol;phosphoric acid |
|---|---|
| PubChem CID | 70615729 |
| Molecular Formula | C22H45N2O5P |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.31 |
| IUPAC Name | 2-(2-heptadec-1-en-9-yl-4,5-dihydroimidazol-1-yl)ethanol;phosphoric acid |
| SMILES | C=CCCCCCCC(CCCCCCCC)C1=NCCN1CCO.O=P(O)(O)O |
| InChI | InChI=1S/C22H42N2O.H3O4P/c1-3-5-7-9-11-13-15-21(16-14-12-10-8-6-4-2)22-23-17-18-24(22)19-20-25;1-5(2,3)4/h3,21,25H,1,4-20H2,2H3;(H3,1,2,3,4) |
| InChIKey | PVFQWPKFJDCJIB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|