C25H20ClN5O3 — CID 22291694
8-[(5-amino-2-chlorobenzoyl)amino]-1-(4-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide (PubChem CID 22291694) has the molecular formula C25H20ClN5O3 and a molecular weight of 473.92 g/mol. Its IUPAC name is 8-[(5-amino-2-chlorobenzoyl)amino]-1-(4-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide.
| Compound Name | 8-[(5-amino-2-chlorobenzoyl)amino]-1-(4-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 22291694 |
| Molecular Formula | C25H20ClN5O3 |
| Molecular Weight | 473.92 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 8-[(5-amino-2-chlorobenzoyl)amino]-1-(4-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(-c2ccc(O)cc2)c2c1CCc1ccc(NC(=O)c3cc(N)ccc3Cl)cc1-2 |
| InChI | InChI=1S/C25H20ClN5O3/c26-21-10-3-14(27)11-20(21)25(34)29-15-4-1-13-2-9-18-22(24(28)33)30-31(23(18)19(13)12-15)16-5-7-17(32)8-6-16/h1,3-8,10-12,32H,2,9,27H2,(H2,28,33)(H,29,34) |
| InChIKey | ONACAMJPIPNTHR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.92 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|