C13H18INO — CID 22292799
7-iodo-8-methoxy-3,5-dimethyl-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 22292799) has the molecular formula C13H18INO and a molecular weight of 331.20 g/mol. Its IUPAC name is 7-iodo-8-methoxy-3,5-dimethyl-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 7-iodo-8-methoxy-3,5-dimethyl-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 22292799 |
| Molecular Formula | C13H18INO |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 7-iodo-8-methoxy-3,5-dimethyl-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | COc1cc2c(cc1I)C(C)CN(C)CC2 |
| InChI | InChI=1S/C13H18INO/c1-9-8-15(2)5-4-10-6-13(16-3)12(14)7-11(9)10/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | KXTAUGYNHFAGFL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|