C18H19ClINO — CID 14547195
8-chloro-5-(4-iodophenyl)-7-methoxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 14547195) has the molecular formula C18H19ClINO and a molecular weight of 427.71 g/mol. Its IUPAC name is 8-chloro-5-(4-iodophenyl)-7-methoxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 8-chloro-5-(4-iodophenyl)-7-methoxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 14547195 |
| Molecular Formula | C18H19ClINO |
| Molecular Weight | 427.71 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 8-chloro-5-(4-iodophenyl)-7-methoxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | COc1cc2c(cc1Cl)CCN(C)CC2c1ccc(I)cc1 |
| InChI | InChI=1S/C18H19ClINO/c1-21-8-7-13-9-17(19)18(22-2)10-15(13)16(11-21)12-3-5-14(20)6-4-12/h3-6,9-10,16H,7-8,11H2,1-2H3 |
| InChIKey | USGZTFOWXOZPGJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.71 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|