C18H22N2O — CID 68734998
4-(7-methoxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepin-5-yl)aniline (PubChem CID 68734998) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 4-(7-methoxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepin-5-yl)aniline.
| Compound Name | 4-(7-methoxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepin-5-yl)aniline |
|---|---|
| PubChem CID | 68734998 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 4-(7-methoxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepin-5-yl)aniline |
| SMILES | COc1ccc2c(c1)C(c1ccc(N)cc1)CN(C)CC2 |
| InChI | InChI=1S/C18H22N2O/c1-20-10-9-14-5-8-16(21-2)11-17(14)18(12-20)13-3-6-15(19)7-4-13/h3-8,11,18H,9-10,12,19H2,1-2H3 |
| InChIKey | LHFHTIGSEYMRAC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|