C18H21BrN2 — CID 58536846
4-(8-bromo-3,7-dimethyl-1,2,4,5-tetrahydro-3-benzazepin-5-yl)aniline (PubChem CID 58536846) has the molecular formula C18H21BrN2 and a molecular weight of 345.28 g/mol. Its IUPAC name is 4-(8-bromo-3,7-dimethyl-1,2,4,5-tetrahydro-3-benzazepin-5-yl)aniline.
| Compound Name | 4-(8-bromo-3,7-dimethyl-1,2,4,5-tetrahydro-3-benzazepin-5-yl)aniline |
|---|---|
| PubChem CID | 58536846 |
| Molecular Formula | C18H21BrN2 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 4-(8-bromo-3,7-dimethyl-1,2,4,5-tetrahydro-3-benzazepin-5-yl)aniline |
| SMILES | Cc1cc2c(cc1Br)CCN(C)CC2c1ccc(N)cc1 |
| InChI | InChI=1S/C18H21BrN2/c1-12-9-16-14(10-18(12)19)7-8-21(2)11-17(16)13-3-5-15(20)6-4-13/h3-6,9-10,17H,7-8,11,20H2,1-2H3 |
| InChIKey | JSXOOSFVZYECTC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|