C18H19BrN2O2 — CID 58536848
8-bromo-3,7-dimethyl-5-(4-nitrophenyl)-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 58536848) has the molecular formula C18H19BrN2O2 and a molecular weight of 375.27 g/mol. Its IUPAC name is 8-bromo-3,7-dimethyl-5-(4-nitrophenyl)-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 8-bromo-3,7-dimethyl-5-(4-nitrophenyl)-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 58536848 |
| Molecular Formula | C18H19BrN2O2 |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 8-bromo-3,7-dimethyl-5-(4-nitrophenyl)-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | Cc1cc2c(cc1Br)CCN(C)CC2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H19BrN2O2/c1-12-9-16-14(10-18(12)19)7-8-20(2)11-17(16)13-3-5-15(6-4-13)21(22)23/h3-6,9-10,17H,7-8,11H2,1-2H3 |
| InChIKey | PMUAMYRSLGJBJN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|