C11H14N4O — CID 22294536
4-amino-4-(2-methylanilino)-1,3-dihydropyrimidin-2-one (PubChem CID 22294536) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-amino-4-(2-methylanilino)-1,3-dihydropyrimidin-2-one.
| Compound Name | 4-amino-4-(2-methylanilino)-1,3-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 22294536 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-amino-4-(2-methylanilino)-1,3-dihydropyrimidin-2-one |
| SMILES | Cc1ccccc1NC1(N)C=CNC(=O)N1 |
| InChI | InChI=1S/C11H14N4O/c1-8-4-2-3-5-9(8)14-11(12)6-7-13-10(16)15-11/h2-7,14H,12H2,1H3,(H2,13,15,16) |
| InChIKey | WQXYDHMHDFCIFG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|