C11H12N4O2 — CID 136951403
(6E)-6-[(2-methylphenyl)hydrazinylidene]-1,3-diazinane-2,4-dione (PubChem CID 136951403) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is (6E)-6-[(2-methylphenyl)hydrazinylidene]-1,3-diazinane-2,4-dione.
| Compound Name | (6E)-6-[(2-methylphenyl)hydrazinylidene]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 136951403 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (6E)-6-[(2-methylphenyl)hydrazinylidene]-1,3-diazinane-2,4-dione |
| SMILES | Cc1ccccc1N/N=C1\CC(=O)NC(=O)N1 |
| InChI | InChI=1S/C11H12N4O2/c1-7-4-2-3-5-8(7)14-15-9-6-10(16)13-11(17)12-9/h2-5,14H,6H2,1H3,(H2,12,13,15,16,17) |
| InChIKey | VOCBDWVKJQALRB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|