C25H26F10O4 — CID 22297115
[(8R,9S,10R,13S,14S)-10,13-dimethyl-3-(2,2,2-trifluoroacetyl)oxy-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 22297115) has the molecular formula C25H26F10O4 and a molecular weight of 580.46 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S)-10,13-dimethyl-3-(2,2,2-trifluoroacetyl)oxy-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [(8R,9S,10R,13S,14S)-10,13-dimethyl-3-(2,2,2-trifluoroacetyl)oxy-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 22297115 |
| Molecular Formula | C25H26F10O4 |
| Molecular Weight | 580.46 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | [(8R,9S,10R,13S,14S)-10,13-dimethyl-3-(2,2,2-trifluoroacetyl)oxy-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | C[C@]12CCC(OC(=O)C(F)(F)F)=CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)CC[C@@H]12 |
| InChI | InChI=1S/C25H26F10O4/c1-20-9-7-13(38-19(37)23(28,29)30)11-12(20)3-4-14-15-5-6-17(21(15,2)10-8-16(14)20)39-18(36)22(26,27)24(31,32)25(33,34)35/h3,11,14-17H,4-10H2,1-2H3/t14-,15-,16-,17?,20-,21-/m0/s1 |
| InChIKey | JEYCSCXDTOFLCH-HYGUSNFJSA-N |
| XLogP | 7.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.46 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|