C20H34O3 — CID 22297263
(4S,8R,9S,10R,13R,14R)-14-(hydroxymethyl)-5,5,9,13-tetramethyl-15-oxatetracyclo[11.2.1.01,10.04,9]hexadecan-8-ol (PubChem CID 22297263) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (4S,8R,9S,10R,13R,14R)-14-(hydroxymethyl)-5,5,9,13-tetramethyl-15-oxatetracyclo[11.2.1.01,10.04,9]hexadecan-8-ol.
| Compound Name | (4S,8R,9S,10R,13R,14R)-14-(hydroxymethyl)-5,5,9,13-tetramethyl-15-oxatetracyclo[11.2.1.01,10.04,9]hexadecan-8-ol |
|---|---|
| PubChem CID | 22297263 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (4S,8R,9S,10R,13R,14R)-14-(hydroxymethyl)-5,5,9,13-tetramethyl-15-oxatetracyclo[11.2.1.01,10.04,9]hexadecan-8-ol |
| SMILES | CC1(C)CC[C@@H](O)[C@@]2(C)[C@H]1CCC13C[C@@](C)(CC[C@@H]12)[C@H](CO)O3 |
| InChI | InChI=1S/C20H34O3/c1-17(2)8-7-15(22)19(4)13(17)6-10-20-12-18(3,9-5-14(19)20)16(11-21)23-20/h13-16,21-22H,5-12H2,1-4H3/t13-,14+,15+,16-,18+,19-,20?/m0/s1 |
| InChIKey | PWCNHZBWVVQRMD-HOMCEZQUSA-N |
| XLogP | 3.52 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |