C29H38O10 — CID 22297734
methyl 2-[(1R,7aS,8S,9S,11bS)-1-acetyloxy-9-(furan-3-carbonyl)-8-hydroxy-5,5,7a,9,11b-pentamethyl-3,7-dioxo-2,5a,6,10,11,11a-hexahydro-1H-naphtho[2,1-c]oxepin-8-yl]acetate (PubChem CID 22297734) has the molecular formula C29H38O10 and a molecular weight of 546.61 g/mol. Its IUPAC name is methyl 2-[(1R,7aS,8S,9S,11bS)-1-acetyloxy-9-(furan-3-carbonyl)-8-hydroxy-5,5,7a,9,11b-pentamethyl-3,7-dioxo-2,5a,6,10,11,11a-hexahydro-1H-naphtho[2,1-c]oxepin-8-yl]acetate.
| Compound Name | methyl 2-[(1R,7aS,8S,9S,11bS)-1-acetyloxy-9-(furan-3-carbonyl)-8-hydroxy-5,5,7a,9,11b-pentamethyl-3,7-dioxo-2,5a,6,10,11,11a-hexahydro-1H-naphtho[2,1-c]oxepin-8-yl]acetate |
|---|---|
| PubChem CID | 22297734 |
| Molecular Formula | C29H38O10 |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | methyl 2-[(1R,7aS,8S,9S,11bS)-1-acetyloxy-9-(furan-3-carbonyl)-8-hydroxy-5,5,7a,9,11b-pentamethyl-3,7-dioxo-2,5a,6,10,11,11a-hexahydro-1H-naphtho[2,1-c]oxepin-8-yl]acetate |
| SMILES | COC(=O)C[C@@]1(O)[C@@]2(C)C(=O)CC3C(C)(C)OC(=O)C[C@@H](OC(C)=O)[C@@]3(C)C2CC[C@]1(C)C(=O)c1ccoc1 |
| InChI | InChI=1S/C29H38O10/c1-16(30)38-21-13-22(32)39-25(2,3)19-12-20(31)28(6)18(27(19,21)5)8-10-26(4,24(34)17-9-11-37-15-17)29(28,35)14-23(33)36-7/h9,11,15,18-19,21,35H,8,10,12-14H2,1-7H3/t18?,19?,21-,26-,27+,28-,29+/m1/s1 |
| InChIKey | OXGWTRSVBLAIAN-ZHCWXTJOSA-N |
| XLogP | 3.43 |
| TPSA | 146.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|