C16H15N3O3S — CID 22299438
1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(3-methylphenyl)sulfanylurea (PubChem CID 22299438) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(3-methylphenyl)sulfanylurea.
| Compound Name | 1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(3-methylphenyl)sulfanylurea |
|---|---|
| PubChem CID | 22299438 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(3-methylphenyl)sulfanylurea |
| SMILES | Cc1cccc(SNC(=O)N/N=C/c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C16H15N3O3S/c1-11-3-2-4-13(7-11)23-19-16(20)18-17-9-12-5-6-14-15(8-12)22-10-21-14/h2-9H,10H2,1H3,(H2,18,19,20)/b17-9+ |
| InChIKey | QSJBVVLHZQNZDU-RQZCQDPDSA-N |
| XLogP | 3.06 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|