C17H19IN2O5S — CID 22299911
2-[(2,5-dimethoxyphenyl)methylsulfonylamino]-N-(4-iodophenyl)acetamide (PubChem CID 22299911) has the molecular formula C17H19IN2O5S and a molecular weight of 490.32 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)methylsulfonylamino]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[(2,5-dimethoxyphenyl)methylsulfonylamino]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 22299911 |
| Molecular Formula | C17H19IN2O5S |
| Molecular Weight | 490.32 g/mol |
| Exact Mass | 490.01 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)methylsulfonylamino]-N-(4-iodophenyl)acetamide |
| SMILES | COc1ccc(OC)c(CS(=O)(=O)NCC(=O)Nc2ccc(I)cc2)c1 |
| InChI | InChI=1S/C17H19IN2O5S/c1-24-15-7-8-16(25-2)12(9-15)11-26(22,23)19-10-17(21)20-14-5-3-13(18)4-6-14/h3-9,19H,10-11H2,1-2H3,(H,20,21) |
| InChIKey | JBIRKXDGVGNIJM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|