C23H19N3O3S — CID 22300612
S-[[5-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamoylamino] 2-methylbenzenecarbothioate (PubChem CID 22300612) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is S-[[5-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamoylamino] 2-methylbenzenecarbothioate.
| Compound Name | S-[[5-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamoylamino] 2-methylbenzenecarbothioate |
|---|---|
| PubChem CID | 22300612 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | S-[[5-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamoylamino] 2-methylbenzenecarbothioate |
| SMILES | Cc1ccc(-c2nc3ccccc3o2)cc1NC(=O)NSC(=O)c1ccccc1C |
| InChI | InChI=1S/C23H19N3O3S/c1-14-7-3-4-8-17(14)22(27)30-26-23(28)25-19-13-16(12-11-15(19)2)21-24-18-9-5-6-10-20(18)29-21/h3-13H,1-2H3,(H2,25,26,28) |
| InChIKey | TXMDSNKTIXGPPJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|